/*------------------------------------------------------------------------- * slotsync.c * Functionality for synchronizing slots to a standby server from the * primary server. * * Copyright (c) 2024, PostgreSQL Global Development Group * * IDENTIFICATION * src/backend/replication/logical/slotsync.c * * This file contains the code for slot synchronization on a physical standby * to fetch logical failover slots information from the primary server, create * the slots on the standby and synchronize them. This is done by a call to SQL * function pg_sync_replication_slots. * * If on physical standby, the WAL corresponding to the remote's restart_lsn * is not available or the remote's catalog_xmin precedes the oldest xid for which * it is guaranteed that rows wouldn't have been removed then we cannot create * the local standby slot because that would mean moving the local slot * backward and decoding won't be possible via such a slot. In this case, the * slot will be marked as RS_TEMPORARY. Once the primary server catches up, * the slot will be marked as RS_PERSISTENT (which means sync-ready) after * which we can call pg_sync_replication_slots() periodically to perform * syncs. * * Any standby synchronized slots will be dropped if they no longer need * to be synchronized. See comment atop drop_local_obsolete_slots() for more * details. *--------------------------------------------------------------------------- */ #include "postgres.h" #include "access/xlog_internal.h" #include "access/xlogrecovery.h" #include "catalog/pg_database.h" #include "commands/dbcommands.h" #include "replication/logical.h" #include "replication/slotsync.h" #include "storage/ipc.h" #include "storage/lmgr.h" #include "storage/procarray.h" #include "utils/builtins.h" #include "utils/pg_lsn.h" /* Struct for sharing information to control slot synchronization. */ typedef struct SlotSyncCtxStruct { /* prevents concurrent slot syncs to avoid slot overwrites */ bool syncing; slock_t mutex; } SlotSyncCtxStruct; SlotSyncCtxStruct *SlotSyncCtx = NULL; /* * Flag to tell if we are syncing replication slots. Unlike the 'syncing' flag * in SlotSyncCtxStruct, this flag is true only if the current process is * performing slot synchronization. */ static bool syncing_slots = false; /* * Structure to hold information fetched from the primary server about a logical * replication slot. */ typedef struct RemoteSlot { char *name; char *plugin; char *database; bool two_phase; bool failover; XLogRecPtr restart_lsn; XLogRecPtr confirmed_lsn; TransactionId catalog_xmin; /* RS_INVAL_NONE if valid, or the reason of invalidation */ ReplicationSlotInvalidationCause invalidated; } RemoteSlot; /* * If necessary, update the local synced slot's metadata based on the data * from the remote slot. * * If no update was needed (the data of the remote slot is the same as the * local slot) return false, otherwise true. */ static bool update_local_synced_slot(RemoteSlot *remote_slot, Oid remote_dbid) { ReplicationSlot *slot = MyReplicationSlot; bool xmin_changed; bool restart_lsn_changed; NameData plugin_name; Assert(slot->data.invalidated == RS_INVAL_NONE); xmin_changed = (remote_slot->catalog_xmin != slot->data.catalog_xmin); restart_lsn_changed = (remote_slot->restart_lsn != slot->data.restart_lsn); if (!xmin_changed && !restart_lsn_changed && remote_dbid == slot->data.database && remote_slot->two_phase == slot->data.two_phase && remote_slot->failover == slot->data.failover && remote_slot->confirmed_lsn == slot->data.confirmed_flush && strcmp(remote_slot->plugin, NameStr(slot->data.plugin)) == 0) return false; /* Avoid expensive operations while holding a spinlock. */ namestrcpy(&plugin_name, remote_slot->plugin); SpinLockAcquire(&slot->mutex); slot->data.plugin = plugin_name; slot->data.database = remote_dbid; slot->data.two_phase = remote_slot->two_phase; slot->data.failover = remote_slot->failover; slot->data.restart_lsn = remote_slot->restart_lsn; slot->data.confirmed_flush = remote_slot->confirmed_lsn; slot->data.catalog_xmin = remote_slot->catalog_xmin; slot->effective_catalog_xmin = remote_slot->catalog_xmin; SpinLockRelease(&slot->mutex); if (xmin_changed) ReplicationSlotsComputeRequiredXmin(false); if (restart_lsn_changed) ReplicationSlotsComputeRequiredLSN(); return true; } /* * Get the list of local logical slots that are synchronized from the * primary server. */ static List * get_local_synced_slots(void) { List *local_slots = NIL; LWLockAcquire(ReplicationSlotControlLock, LW_SHARED); for (int i = 0; i < max_replication_slots; i++) { ReplicationSlot *s = &ReplicationSlotCtl->replication_slots[i]; /* Check if it is a synchronized slot */ if (s->in_use && s->data.synced) { Assert(SlotIsLogical(s)); local_slots = lappend(local_slots, s); } } LWLockRelease(ReplicationSlotControlLock); return local_slots; } /* * Helper function to check if local_slot is required to be retained. * * Return false either if local_slot does not exist in the remote_slots list * or is invalidated while the corresponding remote slot is still valid, * otherwise true. */ static bool local_sync_slot_required(ReplicationSlot *local_slot, List *remote_slots) { bool remote_exists = false; bool locally_invalidated = false; foreach_ptr(RemoteSlot, remote_slot, remote_slots) { if (strcmp(remote_slot->name, NameStr(local_slot->data.name)) == 0) { remote_exists = true; /* * If remote slot is not invalidated but local slot is marked as * invalidated, then set locally_invalidated flag. */ SpinLockAcquire(&local_slot->mutex); locally_invalidated = (remote_slot->invalidated == RS_INVAL_NONE) && (local_slot->data.invalidated != RS_INVAL_NONE); SpinLockRelease(&local_slot->mutex); break; } } return (remote_exists && !locally_invalidated); } /* * Drop local obsolete slots. * * Drop the local slots that no longer need to be synced i.e. these either do * not exist on the primary or are no longer enabled for failover. * * Additionally, drop any slots that are valid on the primary but got * invalidated on the standby. This situation may occur due to the following * reasons: * - The 'max_slot_wal_keep_size' on the standby is insufficient to retain WAL * records from the restart_lsn of the slot. * - 'primary_slot_name' is temporarily reset to null and the physical slot is * removed. * These dropped slots will get recreated in next sync-cycle and it is okay to * drop and recreate such slots as long as these are not consumable on the * standby (which is the case currently). * * Note: Change of 'wal_level' on the primary server to a level lower than * logical may also result in slot invalidation and removal on the standby. * This is because such 'wal_level' change is only possible if the logical * slots are removed on the primary server, so it's expected to see the * slots being invalidated and removed on the standby too (and re-created * if they are re-created on the primary server). */ static void drop_local_obsolete_slots(List *remote_slot_list) { List *local_slots = get_local_synced_slots(); foreach_ptr(ReplicationSlot, local_slot, local_slots) { /* Drop the local slot if it is not required to be retained. */ if (!local_sync_slot_required(local_slot, remote_slot_list)) { bool synced_slot; /* * Use shared lock to prevent a conflict with * ReplicationSlotsDropDBSlots(), trying to drop the same slot * during a drop-database operation. */ LockSharedObject(DatabaseRelationId, local_slot->data.database, 0, AccessShareLock); /* * In the small window between getting the slot to drop and * locking the database, there is a possibility of a parallel * database drop by the startup process and the creation of a new * slot by the user. This new user-created slot may end up using * the same shared memory as that of 'local_slot'. Thus check if * local_slot is still the synced one before performing actual * drop. */ SpinLockAcquire(&local_slot->mutex); synced_slot = local_slot->in_use && local_slot->data.synced; SpinLockRelease(&local_slot->mutex); if (synced_slot) { ReplicationSlotAcquire(NameStr(local_slot->data.name), true); ReplicationSlotDropAcquired(); } UnlockSharedObject(DatabaseRelationId, local_slot->data.database, 0, AccessShareLock); ereport(LOG, errmsg("dropped replication slot \"%s\" of dbid %d", NameStr(local_slot->data.name), local_slot->data.database)); } } } /* * Reserve WAL for the currently active local slot using the specified WAL * location (restart_lsn). * * If the given WAL location has been removed, reserve WAL using the oldest * existing WAL segment. */ static void reserve_wal_for_local_slot(XLogRecPtr restart_lsn) { XLogSegNo oldest_segno; XLogSegNo segno; ReplicationSlot *slot = MyReplicationSlot; Assert(slot != NULL); Assert(XLogRecPtrIsInvalid(slot->data.restart_lsn)); while (true) { SpinLockAcquire(&slot->mutex); slot->data.restart_lsn = restart_lsn; SpinLockRelease(&slot->mutex); /* Prevent WAL removal as fast as possible */ ReplicationSlotsComputeRequiredLSN(); XLByteToSeg(slot->data.restart_lsn, segno, wal_segment_size); /* * Find the oldest existing WAL segment file. * * Normally, we can determine it by using the last removed segment * number. However, if no WAL segment files have been removed by a * checkpoint since startup, we need to search for the oldest segment * file from the current timeline existing in XLOGDIR. * * XXX: Currently, we are searching for the oldest segment in the * current timeline as there is less chance of the slot's restart_lsn * from being some prior timeline, and even if it happens, in the * worst case, we will wait to sync till the slot's restart_lsn moved * to the current timeline. */ oldest_segno = XLogGetLastRemovedSegno() + 1; if (oldest_segno == 1) { TimeLineID cur_timeline; GetWalRcvFlushRecPtr(NULL, &cur_timeline); oldest_segno = XLogGetOldestSegno(cur_timeline); } elog(DEBUG1, "segno: " UINT64_FORMAT " of purposed restart_lsn for the synced slot, oldest_segno: " UINT64_FORMAT " available", segno, oldest_segno); /* * If all required WAL is still there, great, otherwise retry. The * slot should prevent further removal of WAL, unless there's a * concurrent ReplicationSlotsComputeRequiredLSN() after we've written * the new restart_lsn above, so normally we should never need to loop * more than twice. */ if (segno >= oldest_segno) break; /* Retry using the location of the oldest wal segment */ XLogSegNoOffsetToRecPtr(oldest_segno, 0, wal_segment_size, restart_lsn); } } /* * If the remote restart_lsn and catalog_xmin have caught up with the * local ones, then update the LSNs and persist the local synced slot for * future synchronization; otherwise, do nothing. */ static void update_and_persist_local_synced_slot(RemoteSlot *remote_slot, Oid remote_dbid) { ReplicationSlot *slot = MyReplicationSlot; /* * Check if the primary server has caught up. Refer to the comment atop * the file for details on this check. */ if (remote_slot->restart_lsn < slot->data.restart_lsn || TransactionIdPrecedes(remote_slot->catalog_xmin, slot->data.catalog_xmin)) { /* * The remote slot didn't catch up to locally reserved position. * * We do not drop the slot because the restart_lsn can be ahead of the * current location when recreating the slot in the next cycle. It may * take more time to create such a slot. Therefore, we keep this slot * and attempt the synchronization in the next cycle. * * XXX should this be changed to elog(DEBUG1) perhaps? */ ereport(LOG, errmsg("could not sync slot information as remote slot precedes local slot:" " remote slot \"%s\": LSN (%X/%X), catalog xmin (%u) local slot: LSN (%X/%X), catalog xmin (%u)", remote_slot->name, LSN_FORMAT_ARGS(remote_slot->restart_lsn), remote_slot->catalog_xmin, LSN_FORMAT_ARGS(slot->data.restart_lsn), slot->data.catalog_xmin)); return; } /* First time slot update, the function must return true */ if (!update_local_synced_slot(remote_slot, remote_dbid)) elog(ERROR, "failed to update slot"); ReplicationSlotPersist(); ereport(LOG, errmsg("newly created slot \"%s\" is sync-ready now", remote_slot->name)); } /* * Synchronize a single slot to the given position. * * This creates a new slot if there is no existing one and updates the * metadata of the slot as per the data received from the primary server. * * The slot is created as a temporary slot and stays in the same state until the * the remote_slot catches up with locally reserved position and local slot is * updated. The slot is then persisted and is considered as sync-ready for * periodic syncs. */ static void synchronize_one_slot(RemoteSlot *remote_slot, Oid remote_dbid) { ReplicationSlot *slot; XLogRecPtr latestFlushPtr; /* * Make sure that concerned WAL is received and flushed before syncing * slot to target lsn received from the primary server. */ latestFlushPtr = GetStandbyFlushRecPtr(NULL); if (remote_slot->confirmed_lsn > latestFlushPtr) elog(ERROR, "skipping slot synchronization as the received slot sync" " LSN %X/%X for slot \"%s\" is ahead of the standby position %X/%X", LSN_FORMAT_ARGS(remote_slot->confirmed_lsn), remote_slot->name, LSN_FORMAT_ARGS(latestFlushPtr)); /* Search for the named slot */ if ((slot = SearchNamedReplicationSlot(remote_slot->name, true))) { bool synced; SpinLockAcquire(&slot->mutex); synced = slot->data.synced; SpinLockRelease(&slot->mutex); /* User-created slot with the same name exists, raise ERROR. */ if (!synced) ereport(ERROR, errcode(ERRCODE_OBJECT_NOT_IN_PREREQUISITE_STATE), errmsg("exiting from slot synchronization because same" " name slot \"%s\" already exists on the standby", remote_slot->name)); /* * The slot has been synchronized before. * * It is important to acquire the slot here before checking * invalidation. If we don't acquire the slot first, there could be a * race condition that the local slot could be invalidated just after * checking the 'invalidated' flag here and we could end up * overwriting 'invalidated' flag to remote_slot's value. See * InvalidatePossiblyObsoleteSlot() where it invalidates slot directly * if the slot is not acquired by other processes. */ ReplicationSlotAcquire(remote_slot->name, true); Assert(slot == MyReplicationSlot); /* * Copy the invalidation cause from remote only if local slot is not * invalidated locally, we don't want to overwrite existing one. */ if (slot->data.invalidated == RS_INVAL_NONE && remote_slot->invalidated != RS_INVAL_NONE) { SpinLockAcquire(&slot->mutex); slot->data.invalidated = remote_slot->invalidated; SpinLockRelease(&slot->mutex); /* Make sure the invalidated state persists across server restart */ ReplicationSlotMarkDirty(); ReplicationSlotSave(); } /* Skip the sync of an invalidated slot */ if (slot->data.invalidated != RS_INVAL_NONE) { ReplicationSlotRelease(); return; } /* Slot not ready yet, let's attempt to make it sync-ready now. */ if (slot->data.persistency == RS_TEMPORARY) { update_and_persist_local_synced_slot(remote_slot, remote_dbid); } /* Slot ready for sync, so sync it. */ else { /* * Sanity check: As long as the invalidations are handled * appropriately as above, this should never happen. */ if (remote_slot->restart_lsn < slot->data.restart_lsn) elog(ERROR, "cannot synchronize local slot \"%s\" LSN(%X/%X)" " to remote slot's LSN(%X/%X) as synchronization" " would move it backwards", remote_slot->name, LSN_FORMAT_ARGS(slot->data.restart_lsn), LSN_FORMAT_ARGS(remote_slot->restart_lsn)); /* Make sure the slot changes persist across server restart */ if (update_local_synced_slot(remote_slot, remote_dbid)) { ReplicationSlotMarkDirty(); ReplicationSlotSave(); } } } /* Otherwise create the slot first. */ else { NameData plugin_name; TransactionId xmin_horizon = InvalidTransactionId; /* Skip creating the local slot if remote_slot is invalidated already */ if (remote_slot->invalidated != RS_INVAL_NONE) return; /* * We create temporary slots instead of ephemeral slots here because * we want the slots to survive after releasing them. This is done to * avoid dropping and re-creating the slots in each synchronization * cycle if the restart_lsn or catalog_xmin of the remote slot has not * caught up. */ ReplicationSlotCreate(remote_slot->name, true, RS_TEMPORARY, remote_slot->two_phase, remote_slot->failover, true); /* For shorter lines. */ slot = MyReplicationSlot; /* Avoid expensive operations while holding a spinlock. */ namestrcpy(&plugin_name, remote_slot->plugin); SpinLockAcquire(&slot->mutex); slot->data.database = remote_dbid; slot->data.plugin = plugin_name; SpinLockRelease(&slot->mutex); reserve_wal_for_local_slot(remote_slot->restart_lsn); LWLockAcquire(ProcArrayLock, LW_EXCLUSIVE); xmin_horizon = GetOldestSafeDecodingTransactionId(true); SpinLockAcquire(&slot->mutex); slot->effective_catalog_xmin = xmin_horizon; slot->data.catalog_xmin = xmin_horizon; SpinLockRelease(&slot->mutex); ReplicationSlotsComputeRequiredXmin(true); LWLockRelease(ProcArrayLock); update_and_persist_local_synced_slot(remote_slot, remote_dbid); } ReplicationSlotRelease(); } /* * Synchronize slots. * * Gets the failover logical slots info from the primary server and updates * the slots locally. Creates the slots if not present on the standby. */ static void synchronize_slots(WalReceiverConn *wrconn) { #define SLOTSYNC_COLUMN_COUNT 9 Oid slotRow[SLOTSYNC_COLUMN_COUNT] = {TEXTOID, TEXTOID, LSNOID, LSNOID, XIDOID, BOOLOID, BOOLOID, TEXTOID, TEXTOID}; WalRcvExecResult *res; TupleTableSlot *tupslot; StringInfoData s; List *remote_slot_list = NIL; SpinLockAcquire(&SlotSyncCtx->mutex); if (SlotSyncCtx->syncing) { SpinLockRelease(&SlotSyncCtx->mutex); ereport(ERROR, errcode(ERRCODE_OBJECT_NOT_IN_PREREQUISITE_STATE), errmsg("cannot synchronize replication slots concurrently")); } SlotSyncCtx->syncing = true; SpinLockRelease(&SlotSyncCtx->mutex); syncing_slots = true; initStringInfo(&s); /* Construct query to fetch slots with failover enabled. */ appendStringInfo(&s, "SELECT slot_name, plugin, confirmed_flush_lsn," " restart_lsn, catalog_xmin, two_phase, failover," " database, conflict_reason" " FROM pg_catalog.pg_replication_slots" " WHERE failover and NOT temporary"); /* Execute the query */ res = walrcv_exec(wrconn, s.data, SLOTSYNC_COLUMN_COUNT, slotRow); pfree(s.data); if (res->status != WALRCV_OK_TUPLES) ereport(ERROR, errmsg("could not fetch failover logical slots info from the primary server: %s", res->err)); /* Construct the remote_slot tuple and synchronize each slot locally */ tupslot = MakeSingleTupleTableSlot(res->tupledesc, &TTSOpsMinimalTuple); while (tuplestore_gettupleslot(res->tuplestore, true, false, tupslot)) { bool isnull; RemoteSlot *remote_slot = palloc0(sizeof(RemoteSlot)); Datum d; int col = 0; remote_slot->name = TextDatumGetCString(slot_getattr(tupslot, ++col, &isnull)); Assert(!isnull); remote_slot->plugin = TextDatumGetCString(slot_getattr(tupslot, ++col, &isnull)); Assert(!isnull); /* * It is possible to get null values for LSN and Xmin if slot is * invalidated on the primary server, so handle accordingly. */ d = slot_getattr(tupslot, ++col, &isnull); remote_slot->confirmed_lsn = isnull ? InvalidXLogRecPtr : DatumGetLSN(d); d = slot_getattr(tupslot, ++col, &isnull); remote_slot->restart_lsn = isnull ? InvalidXLogRecPtr : DatumGetLSN(d); d = slot_getattr(tupslot, ++col, &isnull); remote_slot->catalog_xmin = isnull ? InvalidTransactionId : DatumGetTransactionId(d); remote_slot->two_phase = DatumGetBool(slot_getattr(tupslot, ++col, &isnull)); Assert(!isnull); remote_slot->failover = DatumGetBool(slot_getattr(tupslot, ++col, &isnull)); Assert(!isnull); remote_slot->database = TextDatumGetCString(slot_getattr(tupslot, ++col, &isnull)); Assert(!isnull); d = slot_getattr(tupslot, ++col, &isnull); remote_slot->invalidated = isnull ? RS_INVAL_NONE : GetSlotInvalidationCause(TextDatumGetCString(d)); /* Sanity check */ Assert(col == SLOTSYNC_COLUMN_COUNT); /* * If restart_lsn, confirmed_lsn or catalog_xmin is invalid but the * slot is valid, that means we have fetched the remote_slot in its * RS_EPHEMERAL state. In such a case, don't sync it; we can always * sync it in the next sync cycle when the remote_slot is persisted * and has valid lsn(s) and xmin values. * * XXX: In future, if we plan to expose 'slot->data.persistency' in * pg_replication_slots view, then we can avoid fetching RS_EPHEMERAL * slots in the first place. */ if ((XLogRecPtrIsInvalid(remote_slot->restart_lsn) || XLogRecPtrIsInvalid(remote_slot->confirmed_lsn) || !TransactionIdIsValid(remote_slot->catalog_xmin)) && remote_slot->invalidated == RS_INVAL_NONE) pfree(remote_slot); else /* Create list of remote slots */ remote_slot_list = lappend(remote_slot_list, remote_slot); ExecClearTuple(tupslot); } /* Drop local slots that no longer need to be synced. */ drop_local_obsolete_slots(remote_slot_list); /* Now sync the slots locally */ foreach_ptr(RemoteSlot, remote_slot, remote_slot_list) { Oid remote_dbid = get_database_oid(remote_slot->database, false); /* * Use shared lock to prevent a conflict with * ReplicationSlotsDropDBSlots(), trying to drop the same slot during * a drop-database operation. */ LockSharedObject(DatabaseRelationId, remote_dbid, 0, AccessShareLock); synchronize_one_slot(remote_slot, remote_dbid); UnlockSharedObject(DatabaseRelationId, remote_dbid, 0, AccessShareLock); } /* We are done, free remote_slot_list elements */ list_free_deep(remote_slot_list); walrcv_clear_result(res); SpinLockAcquire(&SlotSyncCtx->mutex); SlotSyncCtx->syncing = false; SpinLockRelease(&SlotSyncCtx->mutex); syncing_slots = false; } /* * Checks the remote server info. * * We ensure that the 'primary_slot_name' exists on the remote server and the * remote server is not a standby node. */ static void validate_remote_info(WalReceiverConn *wrconn) { #define PRIMARY_INFO_OUTPUT_COL_COUNT 2 WalRcvExecResult *res; Oid slotRow[PRIMARY_INFO_OUTPUT_COL_COUNT] = {BOOLOID, BOOLOID}; StringInfoData cmd; bool isnull; TupleTableSlot *tupslot; bool remote_in_recovery; bool primary_slot_valid; initStringInfo(&cmd); appendStringInfo(&cmd, "SELECT pg_is_in_recovery(), count(*) = 1" " FROM pg_catalog.pg_replication_slots" " WHERE slot_type='physical' AND slot_name=%s", quote_literal_cstr(PrimarySlotName)); res = walrcv_exec(wrconn, cmd.data, PRIMARY_INFO_OUTPUT_COL_COUNT, slotRow); pfree(cmd.data); if (res->status != WALRCV_OK_TUPLES) ereport(ERROR, errmsg("could not fetch primary_slot_name \"%s\" info from the primary server: %s", PrimarySlotName, res->err), errhint("Check if \"primary_slot_name\" is configured correctly.")); tupslot = MakeSingleTupleTableSlot(res->tupledesc, &TTSOpsMinimalTuple); if (!tuplestore_gettupleslot(res->tuplestore, true, false, tupslot)) elog(ERROR, "failed to fetch tuple for the primary server slot specified by \"primary_slot_name\""); remote_in_recovery = DatumGetBool(slot_getattr(tupslot, 1, &isnull)); Assert(!isnull); if (remote_in_recovery) ereport(ERROR, errcode(ERRCODE_FEATURE_NOT_SUPPORTED), errmsg("cannot synchronize replication slots from a standby server")); primary_slot_valid = DatumGetBool(slot_getattr(tupslot, 2, &isnull)); Assert(!isnull); if (!primary_slot_valid) ereport(ERROR, errcode(ERRCODE_INVALID_PARAMETER_VALUE), errmsg("bad configuration for slot synchronization"), /* translator: second %s is a GUC variable name */ errdetail("The replication slot \"%s\" specified by \"%s\" does not exist on the primary server.", PrimarySlotName, "primary_slot_name")); ExecClearTuple(tupslot); walrcv_clear_result(res); } /* * Check all necessary GUCs for slot synchronization are set * appropriately, otherwise, raise ERROR. */ void ValidateSlotSyncParams(void) { char *dbname; /* * A physical replication slot(primary_slot_name) is required on the * primary to ensure that the rows needed by the standby are not removed * after restarting, so that the synchronized slot on the standby will not * be invalidated. */ if (PrimarySlotName == NULL || *PrimarySlotName == '\0') ereport(ERROR, /* translator: %s is a GUC variable name */ errcode(ERRCODE_INVALID_PARAMETER_VALUE), errmsg("bad configuration for slot synchronization"), errhint("\"%s\" must be defined.", "primary_slot_name")); /* * hot_standby_feedback must be enabled to cooperate with the physical * replication slot, which allows informing the primary about the xmin and * catalog_xmin values on the standby. */ if (!hot_standby_feedback) ereport(ERROR, /* translator: %s is a GUC variable name */ errcode(ERRCODE_INVALID_PARAMETER_VALUE), errmsg("bad configuration for slot synchronization"), errhint("\"%s\" must be enabled.", "hot_standby_feedback")); /* Logical slot sync/creation requires wal_level >= logical. */ if (wal_level < WAL_LEVEL_LOGICAL) ereport(ERROR, errcode(ERRCODE_INVALID_PARAMETER_VALUE), errmsg("bad configuration for slot synchronization"), errhint("\"wal_level\" must be >= logical.")); /* * The primary_conninfo is required to make connection to primary for * getting slots information. */ if (PrimaryConnInfo == NULL || *PrimaryConnInfo == '\0') ereport(ERROR, /* translator: %s is a GUC variable name */ errcode(ERRCODE_INVALID_PARAMETER_VALUE), errmsg("bad configuration for slot synchronization"), errhint("\"%s\" must be defined.", "primary_conninfo")); /* * The slot synchronization needs a database connection for walrcv_exec to * work. */ dbname = walrcv_get_dbname_from_conninfo(PrimaryConnInfo); if (dbname == NULL) ereport(ERROR, /* * translator: 'dbname' is a specific option; %s is a GUC variable * name */ errcode(ERRCODE_INVALID_PARAMETER_VALUE), errmsg("bad configuration for slot synchronization"), errhint("'dbname' must be specified in \"%s\".", "primary_conninfo")); } /* * Is current process syncing replication slots ? */ bool IsSyncingReplicationSlots(void) { return syncing_slots; } /* * Amount of shared memory required for slot synchronization. */ Size SlotSyncShmemSize(void) { return sizeof(SlotSyncCtxStruct); } /* * Allocate and initialize the shared memory of slot synchronization. */ void SlotSyncShmemInit(void) { bool found; SlotSyncCtx = (SlotSyncCtxStruct *) ShmemInitStruct("Slot Sync Data", SlotSyncShmemSize(), &found); if (!found) { SlotSyncCtx->syncing = false; SpinLockInit(&SlotSyncCtx->mutex); } } /* * Error cleanup callback for slot synchronization. */ static void slotsync_failure_callback(int code, Datum arg) { WalReceiverConn *wrconn = (WalReceiverConn *) DatumGetPointer(arg); if (syncing_slots) { /* * If syncing_slots is true, it indicates that the process errored out * without resetting the flag. So, we need to clean up shared memory * and reset the flag here. */ SpinLockAcquire(&SlotSyncCtx->mutex); SlotSyncCtx->syncing = false; SpinLockRelease(&SlotSyncCtx->mutex); syncing_slots = false; } walrcv_disconnect(wrconn); } /* * Synchronize the failover enabled replication slots using the specified * primary server connection. */ void SyncReplicationSlots(WalReceiverConn *wrconn) { PG_ENSURE_ERROR_CLEANUP(slotsync_failure_callback, PointerGetDatum(wrconn)); { validate_remote_info(wrconn); synchronize_slots(wrconn); } PG_END_ENSURE_ERROR_CLEANUP(slotsync_failure_callback, PointerGetDatum(wrconn)); }